methyl 2,3-dihydroxybenzoate
- Product Namemethyl 2,3-dihydroxybenzoate
- CAS2411-83-8
- MFC8H8O4
- MW168.15
- EINECS219-317-2
- MOL File2411-83-8.mol
Chemical Properties
| Melting point | 78.0 to 82.0 °C |
| Boiling point | 96°C/3.5mmHg(lit.) |
| Density | 1.354±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.98±0.10(Predicted) |
| color | White to Gray to Red |
| InChI | InChI=1S/C8H8O4/c1-12-8(11)5-3-2-4-6(9)7(5)10/h2-4,9-10H,1H3 |
| InChIKey | DOAJWTSNTNAEIY-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC(O)=C1O |
| LogP | 2.060 (est) |
| CAS DataBase Reference | 2411-83-8 |
