2,6-Bis(trifluoromethyl)pyridine
- Product Name2,6-Bis(trifluoromethyl)pyridine
- CAS455-00-5
- MFC7H3F6N
- MW215.1
- EINECS622-745-6
- MOL File455-00-5.mol
Chemical Properties
| Melting point | 55-59 °C |
| Boiling point | 82 °C 18 mm Hg |
| Density | 1.437±0.06 g/cm3(Predicted) |
| Flash point | 153 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -4.12±0.24(Predicted) |
| color | White to Almost white |
| BRN | 188806 |
| InChI | InChI=1S/C7H3F6N/c8-6(9,10)4-2-1-3-5(14-4)7(11,12)13/h1-3H |
| InChIKey | YPDVFTXBESQIPJ-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)=NC(C(F)(F)F)=CC=C1 |
| CAS DataBase Reference | 455-00-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | F,T,Xi |
| Risk Statements | 11-25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2926 4.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, TOXIC |
| HS Code | 29333990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |
