3-Fluoro-4-methylphenol
- Product Name3-Fluoro-4-methylphenol
- CAS452-78-8
- MFC7H7FO
- MW126.13
- EINECS200-110-4
- MOL File452-78-8.mol
Chemical Properties
| Melting point | 72 °C |
| Boiling point | 196 °C |
| Density | 1.17 |
| refractive index | 1.5150 |
| Flash point | 29 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to lump |
| pka | 9.27±0.18(Predicted) |
| color | White to Light yellow to Light orange |
| Odor | Phenol-like |
| InChI | InChI=1S/C7H7FO/c1-5-2-3-6(9)4-7(5)8/h2-4,9H,1H3 |
| InChIKey | GJOOCAXPERKNMN-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C)C(F)=C1 |
| CAS DataBase Reference | 452-78-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 21/22-34-52-36-22 |
| Safety Statements | 26-36/37/39-60-45 |
| RIDADR | 2922 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 |
