3-Fluoro-4-methylaniline
- Product Name3-Fluoro-4-methylaniline
- CAS452-77-7
- MFC7H8FN
- MW125.14
- EINECS207-212-4
- MOL File452-77-7.mol
Chemical Properties
| Melting point | 30-32 °C (lit.) |
| Boiling point | 93°C 12mm |
| Density | 1.093 g/mL at 25 °C (lit.) |
| refractive index | 1.5385-1.5405 |
| Flash point | 88 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.02±0.10(Predicted) |
| form | powder to lump to clear liquid |
| color | Light yellow to Brown |
| Specific Gravity | 1.093 |
| BRN | 2715987 |
| InChI | InChI=1S/C7H8FN/c1-5-2-3-6(9)4-7(5)8/h2-4H,9H2,1H3 |
| InChIKey | MGRHBBRSAFPBIN-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C)C(F)=C1 |
| CAS DataBase Reference | 452-77-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 36/37/38-23/24/25-20/21/22 |
| Safety Statements | 45-36/37/39-26-36/37-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | XU6825000 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1(b) |
| PackingGroup | I |
| HS Code | 29214300 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |