3-(Chlorosulfonyl)benzoic acid
- Product Name3-(Chlorosulfonyl)benzoic acid
- CAS4025-64-3
- MFC7H5ClO4S
- MW220.63
- EINECS223-692-8
- MOL File4025-64-3.mol
Chemical Properties
| Melting point | 128-130 °C(lit.) |
| Boiling point | 402.5±28.0 °C(Predicted) |
| Density | 1.591±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.00±0.10(Predicted) |
| color | White to Brown |
| Sensitive | Moisture Sensitive |
| BRN | 2645465 |
| InChI | 1S/C7H5ClO4S/c8-13(11,12)6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | LMRKXSDOAFUINK-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cccc(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 4025-64-3(CAS DataBase Reference) |
| NIST Chemistry Reference | M-(chlorosulfonyl)benzoic acid(4025-64-3) |
| EPA Substance Registry System | Benzoic acid, 3-(chlorosulfonyl)- (4025-64-3) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-29-22 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
