Methyl methacrylate-d8
- Product NameMethyl methacrylate-d8
- CAS35233-69-3
- MFC5D8O2
- MW108.17
- EINECS252-449-9
- MOL File35233-69-3.mol
Chemical Properties
| Melting point | -48 °C (lit.) |
| Boiling point | 100 °C (lit.) |
| Density | 1.011 g/mL at 25 °C |
| refractive index | n |
| Flash point | 50 °F |
| storage temp. | 2-8°C |
| Stability | Stable, but may polymerize upon exposure to light. Highly flammable - store cold. Hygroscopic. Incompatible with oxidizing agents, bases, amines, peroxides, acids, reducing agents, halogens, polymerization initiators. |
| InChI | 1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3/i1D2,2D3,3D3 |
| InChIKey | VVQNEPGJFQJSBK-MGGKGRBPSA-N |
| SMILES | [2H]\C([2H])=C(\C(=O)OC([2H])([2H])[2H])C([2H])([2H])[2H] |
| CAS DataBase Reference | 35233-69-3 |
| EPA Substance Registry System | Perdeutero(methyl methacrylate) (35233-69-3) |
| CAS Number Unlabeled | 80-62-6 |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11-37/38-43 |
| Safety Statements | 24-37-46 |
| RIDADR | UN 1247 3/PG 2 |
| WGK Germany | 1 |
| RTECS | OZ5075000 |
| TSCA | TSCA listed |
| HS Code | 28459010 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 Skin Irrit. 2 Skin Sens. 1B STOT SE 3 |