N-(2,2,2-Trichloroethoxycarbonyloxy)succinimide
- Product NameN-(2,2,2-Trichloroethoxycarbonyloxy)succinimide
- CAS66065-85-8
- MFC7H6Cl3NO5
- MW290.49
- EINECS
- MOL File66065-85-8.mol
Chemical Properties
| Melting point | 111-113 °C(lit.) |
| Boiling point | 327.5±52.0 °C(Predicted) |
| Density | 1.69±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in dioxane, THF, DMF, CH2Cl2, alcohols, and most common organic solvents. |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C7H6Cl3NO5/c8-7(9,10)3-15-6(14)16-11-4(12)1-2-5(11)13/h1-3H2 |
| InChIKey | WBZXNGAFYBGQFE-UHFFFAOYSA-N |
| SMILES | C(OCC(Cl)(Cl)Cl)(=O)ON1C(=O)CCC1=O |
| CAS DataBase Reference | 66065-85-8 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37 |
| Safety Statements | 26-27-28-36/37/39-60-36/37-9 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29280000 |
