(-)-Diacetone-2-keto-L-gulonic acid monohydrate
- Product Name(-)-Diacetone-2-keto-L-gulonic acid monohydrate
- CAS68539-16-2
- MFC12H20O8
- MW292.28
- EINECS
- MOL File68539-16-2.mol
Chemical Properties
| Melting point | 88-90 °C(lit.) |
| alpha | -20 º (c=2 in methanol) |
| refractive index | -20 ° (C=2, MeOH) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Light yellow |
| optical activity | [α]21/D 20°, c = 2 in methanol |
| Merck | 14,3199 |
| InChI | InChI=1/C12H18O7.H2O/c1-10(2)15-5-6-7(17-10)8-12(16-6,9(13)14)19-11(3,4)18-8;/h6-8H,5H2,1-4H3,(H,13,14);1H2/t6-,7+,8-,12+;/s3 |
| InChIKey | ZFQRGFMVXLSLKZ-ZYRLPJSWNA-N |
| SMILES | C([C@]12OC(C)(C)O[C@@]1([H])[C@]1([H])OC(C)(C)OC[C@]1([H])O2)(=O)O.O |&1:1,7,9,17,r| |
| CAS DataBase Reference | 68539-16-2 |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2940000080 |
| Storage Class | 11 - Combustible Solids |