4,4'-Dinitrodiphenyl disulfide
- Product Name4,4'-Dinitrodiphenyl disulfide
- CAS100-32-3
- MFC12H8N2O4S2
- MW308.33
- EINECS202-840-5
- MOL File100-32-3.mol
Chemical Properties
| Melting point | 181.0 to 186.0 °C |
| Boiling point | 478.8±30.0 °C(Predicted) |
| Density | 1.5285 (rough estimate) |
| refractive index | 1.6510 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Yellow |
| Stability | Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI | InChI=1S/C12H8N2O4S2/c15-13(16)9-1-5-11(6-2-9)19-20-12-7-3-10(4-8-12)14(17)18/h1-8H |
| InChIKey | KWGZRLZJBLEVFZ-UHFFFAOYSA-N |
| SMILES | S(C1=CC=C([N+]([O-])=O)C=C1)SC1=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 100-32-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Di-4-nitrophenyl sulfide(100-32-3) |
| EPA Substance Registry System | Disulfide, bis(4-nitrophenyl) (100-32-3) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-40 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | JO1550000 |
| TSCA | TSCA listed |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 |
