1,1,3,3,5,5-Hexamethyltrisiloxane
- Product Name1,1,3,3,5,5-Hexamethyltrisiloxane
- CAS1189-93-1
- MFC6H20O2Si3
- MW208.48
- EINECS214-716-8
- MOL File1189-93-1.mol
Chemical Properties
| Melting point | -67°C |
| Boiling point | 128 °C (lit.) |
| Density | 0.822 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 59 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.822 |
| Water Solubility | Slightly miscible with water. |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| Sensitive | Moisture Sensitive |
| BRN | 1746341 |
| InChI | 1S/C6H20O2Si3/c1-9(2)7-11(5,6)8-10(3)4/h9-10H,1-6H3 |
| InChIKey | HZBDPZBVINJJET-UHFFFAOYSA-N |
| SMILES | [H][Si](C)(C)O[Si](C)(C)O[Si]([H])(C)C |
| CAS DataBase Reference | 1189-93-1(CAS DataBase Reference) |
| EPA Substance Registry System | Trisiloxane, 1,1,3,3,5,5-hexamethyl- (1189-93-1) |
Safety Information
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-23-24/25 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |
