Potassium hexahydroxoantimonate(V)
- Product NamePotassium hexahydroxoantimonate(V)
- CAS12208-13-8
- MFKO6Sb
- MW256.85
- EINECS235-387-7
- MOL File12208-13-8.mol
Chemical Properties
| Melting point | 240 °C (dec.)(lit.) |
| Density | 3.27[at 20℃] |
| bulk density | 1200kg/m3 |
| storage temp. | Store at +5°C to +30°C. |
| solubility | 20g/l |
| form | Powder |
| color | White |
| PH | 7.5-9.0 (20g/l, H2O, 20℃) |
| Water Solubility | Soluble in water and glycerine. Insoluble in ethanol. |
| Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 |
| InChI | InChI=1S/K.6O.Sb/q+1;6*-1;+5 |
| InChIKey | RYPGMFDNBQLUIQ-UHFFFAOYSA-N |
| SMILES | [Sb+5]([O-])([O-])([O-])([O-])([O-])[O-].[K+] |
| CAS DataBase Reference | 12208-13-8(CAS DataBase Reference) |
| EPA Substance Registry System | Antimonate (Sb(OH)61-), potassium, (OC-6-11)- (12208-13-8) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 20/22-51/53 |
| Safety Statements | 61 |
| RIDADR | UN 1549 6.1/PG 3 |
| WGK Germany | 2 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 28419000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 |