Potassium hexahydroxoantimonate(V)
- Product NamePotassium hexahydroxoantimonate(V)
- CAS12208-13-8
- CBNumberCB1366004
- MFKO6Sb
- MW256.85
- EINECS235-387-7
- MDL NumberMFCD00011415
- MOL File12208-13-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 240 °C (dec.)(lit.) |
| Density | 3.27[at 20℃] |
| bulk density | 1200kg/m3 |
| storage temp. | Store at +5°C to +30°C. |
| solubility | 20g/l |
| form | Powder |
| color | White |
| PH | 7.5-9.0 (20g/l, H2O, 20℃) |
| Water Solubility | Soluble in water and glycerine. Insoluble in ethanol. |
| Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 |
| InChI | InChI=1S/K.6O.Sb/q+1;6*-1;+5 |
| InChIKey | RYPGMFDNBQLUIQ-UHFFFAOYSA-N |
| SMILES | [Sb+5]([O-])([O-])([O-])([O-])([O-])[O-].[K+] |
| CAS DataBase Reference | 12208-13-8(CAS DataBase Reference) |
| EPA Substance Registry System | Antimonate (Sb(OH)61-), potassium, (OC-6-11)- (12208-13-8) |
| UNSPSC Code | 12352302 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H332-H411 | |||||||||
| Precautionary statements | P261-P264-P270-P273-P301+P312-P304+P340+P312 | |||||||||
| Hazard Codes | Xn,N | |||||||||
| Risk Statements | 20/22-51/53 | |||||||||
| Safety Statements | 61 | |||||||||
| RIDADR | UN 1549 6.1/PG 3 | |||||||||
| WGK Germany | 2 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 28419000 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 | |||||||||
| NFPA 704: |
|
