12208-13-8
| Name | POTASSIUM HEXAHYDROXOANTIMONATE(V) |
| CAS | 12208-13-8 |
| EINECS(EC#) | 215-606-2 |
| Molecular Formula | H6KO6Sb |
| MDL Number | MFCD00011415 |
| Molecular Weight | 262.9 |
| MOL File | 12208-13-8.mol |
Chemical Properties
| Melting point | 240 °C (dec.)(lit.) |
| bulk density | 1200kg/m3 |
| density | 3.27[at 20℃] |
| storage temp. | Store at +5°C to +30°C. |
| solubility | 20g/l |
| form | Powder |
| color | White |
| PH | 7.5-9.0 (20g/l, H2O, 20℃) |
| Water Solubility | Soluble in water and glycerine. Insoluble in ethanol. |
| Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 |
| InChI | InChI=1S/K.6O.Sb/q+1;6*-1;+5 |
| InChIKey | RYPGMFDNBQLUIQ-UHFFFAOYSA-N |
| SMILES | [Sb+5]([O-])([O-])([O-])([O-])([O-])[O-].[K+] |
| CAS DataBase Reference | 12208-13-8(CAS DataBase Reference) |
| EPA Substance Registry System | Antimonate (Sb(OH)61-), potassium, (OC-6-11)- (12208-13-8) |
Safety Data
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H332-H411 |
| Precautionary statements | P261-P264-P270-P273-P301+P312-P304+P340+P312 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1549 6.1/PG 3 |
| WGK Germany | 2 |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 28419000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 |