2,4-Difluorobenzylamine
- Product Name2,4-Difluorobenzylamine
- CAS72235-52-0
- MFC7H7F2N
- MW143.13
- EINECS276-502-0
- MOL File72235-52-0.mol
Chemical Properties
| Melting point | 255-256 °C(Solv: N,N-dimethylformamide (68-12-2)) |
| Boiling point | 57 °C/8 mmHg |
| Density | 1.22 |
| refractive index | 1.49 |
| Flash point | 68 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 8.58±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.204 |
| Sensitive | Air Sensitive |
| BRN | 3539259 |
| InChI | InChI=1S/C7H7F2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H,4,10H2 |
| InChIKey | QDZZDVQGBKTLHV-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=C(F)C=C1F |
| CAS DataBase Reference | 72235-52-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45-25 |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
