3-Cyano-2-fluoropyridine
- Product Name3-Cyano-2-fluoropyridine
- CAS3939-13-7
- MFC6H3FN2
- MW122.1
- EINECS678-765-0
- MOL File3939-13-7.mol
Chemical Properties
| Melting point | 27-30°C |
| Boiling point | 214.6±20.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| Flash point | 98℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to lump |
| pka | -3.88±0.10(Predicted) |
| color | White to Dark green |
| BRN | 386567 |
| InChI | InChI=1S/C6H3FN2/c7-6-5(4-8)2-1-3-9-6/h1-3H |
| InChIKey | USIDQCCXMGJOJM-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=CC=C1C#N |
| CAS DataBase Reference | 3939-13-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-5-36/38-22 |
| Safety Statements | 26-36/37/39-36-24/25-23-3 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
