Tricyclohexyltin chloride
- Product NameTricyclohexyltin chloride
- CAS3091-32-5
- MFC18H33ClSn
- MW403.62
- EINECS221-437-5
- MOL File3091-32-5.mol
Chemical Properties
| Melting point | 123-125 °C (lit.) |
| Boiling point | >250°C |
| RTECS | WH6830000 |
| Flash point | >150°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in ethanol, ether, toluene and chloroform. Insoluble in water. |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI | 1S/3C6H11.ClH.Sn/c3*1-2-4-6-5-3-1;;/h3*1H,2-6H2;1H;/q;;;;+1/p-1 |
| InChIKey | OJVZYIKTLISAIH-UHFFFAOYSA-M |
| SMILES | Cl[Sn](C1CCCCC1)(C2CCCCC2)C3CCCCC3 |
| CAS DataBase Reference | 3091-32-5 |
| EPA Substance Registry System | Stannane, chlorotricyclohexyl- (3091-32-5) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-50/53 |
| Safety Statements | 26-28-61-60 |
| RIDADR | 3146 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
