| Melting point |
<0°C |
| Boiling point |
250 °C(lit.) |
| Density |
1.17 g/mL at 25 °C(lit.) |
| vapor pressure |
0-12790Pa at 20-25℃ |
| refractive index |
n20/D 1.461(lit.) |
| Flash point |
216 °F |
| pka |
-2.17±0.20(Predicted) |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| Specific Gravity |
1.170 |
| Water Solubility |
14-1000000000μg/L at 20℃ |
| Hydrolytic Sensitivity |
7: reacts slowly with moisture/water |
| InChI |
1S/C21H45N3O12Si3/c1-28-37(29-2,30-3)16-10-13-22-19(25)23(14-11-17-38(31-4,32-5)33-6)21(27)24(20(22)26)15-12-18-39(34-7,35-8)36-9/h10-18H2,1-9H3 |
| InChIKey |
QWOVEJBDMKHZQK-UHFFFAOYSA-N |
| SMILES |
CO[Si](CCCN1C(=O)N(CCC[Si](OC)(OC)OC)C(=O)N(CCC[Si](OC)(OC)OC)C1=O)(OC)OC |
| LogP |
-4-2.4 at 20℃ |
| CAS DataBase Reference |
26115-70-8 |
| EPA Substance Registry System |
1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris[3-(trimethoxysilyl)propyl]- (26115-70-8) |