2-Bromo-m-xylene
- Product Name2-Bromo-m-xylene
- CAS576-22-7
- MFC8H9Br
- MW185.06
- EINECS209-397-7
- MOL File576-22-7.mol
Chemical Properties
| Melting point | −10 °C(lit.) |
| Boiling point | 206 °C(lit.) |
| Density | 1.389 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 165 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in aqueous solution. Very soluble in ethanol, soluble in acetone and benzene. |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.389 |
| BRN | 1929780 |
| InChI | InChI=1S/C8H9Br/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| InChIKey | MYMYVYZLMUEVED-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=CC(C)=C1Br |
| CAS DataBase Reference | 576-22-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2-bromo-1,3-dimethyl-(576-22-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| RTECS | CY9020000 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
