Thallium(III) trifluoroacetate
- Product NameThallium(III) trifluoroacetate
- CAS23586-53-0
- MFC2H2F3O2Tl
- MW319.41
- EINECS245-761-1
- MOL File23586-53-0.mol
Chemical Properties
| Melting point | 213 °C (dec.) (lit.) |
| storage temp. | 2-8°C |
| form | Fine Powder |
| color | Slightly beige to beige |
| Water Solubility | Soluble in water (decomposes). |
| Sensitive | Hygroscopic |
| Exposure limits | ACGIH: TWA 0.02 mg/m3 (Skin) NIOSH: IDLH 15 mg/m3; TWA 0.1 mg/m3 |
| InChI | 1S/3C2HF3O2.Tl/c3*3-2(4,5)1(6)7;/h3*(H,6,7);/q;;;+3/p-3 |
| InChIKey | PSHNNUKOUQCMSG-UHFFFAOYSA-K |
| SMILES | FC(F)(F)C(=O)O[Tl](OC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| CAS DataBase Reference | 23586-53-0(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, trifluoro-, thallium(3+) salt (23586-53-0) |
Safety Information
| Hazard Codes | T+,N,T |
| Risk Statements | 26/28-33-51/53 |
| Safety Statements | 13-28-45-61 |
| RIDADR | UN 1707 6.1/PG 2 |
| WGK Germany | 3 |
| F | 3-10-23 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29152900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 STOT RE 2 |