2-Bromo-4'-methylacetophenone
- Product Name2-Bromo-4'-methylacetophenone
- CAS619-41-0
- MFC9H9BrO
- MW213.07
- EINECS210-595-0
- MOL File619-41-0.mol
Chemical Properties
| Melting point | 45-49 °C(lit.) |
| Boiling point | 238-239 °C(lit.) |
| Density | 0.993 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 229 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate |
| form | Crystalline Powder or Needles |
| color | White to light yellow |
| BRN | 607041 |
| Stability | Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI | InChI=1S/C9H9BrO/c1-7-2-4-8(5-3-7)9(11)6-10/h2-5H,6H2,1H3 |
| InChIKey | KRVGXFREOJHJAX-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(C)C=C1)CBr |
| CAS DataBase Reference | 619-41-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 2-bromo-1-(4-methylphenyl)-(619-41-0) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-27-37/39 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |