4-(Trifluoromethyl)phenacyl bromide
- Product Name4-(Trifluoromethyl)phenacyl bromide
- CAS383-53-9
- MFC9H6BrF3O
- MW267.04
- EINECS609-544-9
- MOL File383-53-9.mol
Chemical Properties
| Melting point | 45 °C |
| Boiling point | 264.2±40.0 °C(Predicted) |
| Density | 1.592±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Yellow to Orange |
| InChI | 1S/C9H6BrF3O/c10-5-8(14)6-1-3-7(4-2-6)9(11,12)13/h1-4H,5H2 |
| InChIKey | HEMROKPXTCOASZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(cc1)C(=O)CBr |
| CAS DataBase Reference | 383-53-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | CORROSIVE |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
