4-Chloro-2-fluorobenzoic acid
- Product Name4-Chloro-2-fluorobenzoic acid
- CAS446-30-0
- MFC7H4ClFO2
- MW174.56
- EINECS207-162-3
- MOL File446-30-0.mol
Chemical Properties
| Melting point | 204-208 °C (lit.) |
| Boiling point | 274.7±20.0 °C(Predicted) |
| Density | 1.4016 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.04±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | insoluble |
| BRN | 973358 |
| InChI | InChI=1S/C7H4ClFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) |
| InChIKey | ZLPXBWMVZANJJQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Cl)C=C1F |
| CAS DataBase Reference | 446-30-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloro-2-fluorobenzoic acid(446-30-0) |
| EPA Substance Registry System | Benzoic acid, 4-chloro-2-fluoro- (446-30-0) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
