2-Bromo-4-chloro-1-iodobenzene
- Product Name2-Bromo-4-chloro-1-iodobenzene
- CAS31928-44-6
- MFC6H3BrClI
- MW317.35
- EINECS608-682-7
- MOL File31928-44-6.mol
Chemical Properties
| Melting point | 32-35℃ |
| Boiling point | 279℃ |
| Density | 2.272 |
| Flash point | 123℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C6H3BrClI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| InChIKey | CXHXFDQEFKFYQJ-UHFFFAOYSA-N |
| SMILES | C1(I)=CC=C(Cl)C=C1Br |
| CAS DataBase Reference | 31928-44-6 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| Hazard Note | Irritant |
| HS Code | 29039990 |
