Dimethyl-p-nitrophenylphosphate
- Product NameDimethyl-p-nitrophenylphosphate
- CAS950-35-6
- MFC8H10NO6P
- MW247.14
- EINECS
- MOL File950-35-6.mol
Chemical Properties
| Melting point | 0-4 °C |
| Boiling point | 164 °C(Press: 10 Torr) |
| Density | 1.383±0.06 g/cm3(Predicted) |
| refractive index | n20/D 1.523 |
| Flash point | 100 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| color | Pale Yellow to Light Yellow |
| BRN | 1884904 |
| Henry's Law Constant | 1.1×104 mol/(m3Pa) at 25℃, Woodrow et al. (1990) |
| Major Application | agriculture environmental |
| InChI | 1S/C8H10NO6P/c1-13-16(12,14-2)15-8-5-3-7(4-6-8)9(10)11/h3-6H,1-2H3 |
| InChIKey | BAFQDKPJKOLXFZ-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)Oc1ccc(cc1)[N+]([O-])=O |
| EPA Substance Registry System | Methyl paraoxon (950-35-6) |
Safety Information
| Hazard Codes | T+ |
| Risk Statements | 28 |
| Safety Statements | 28-36/37-45 |
| RIDADR | 3018 |
| WGK Germany | 3 |
| RTECS | TC5250000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 1 Inhalation Acute Tox. 1 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 1 |