Omeprazole sodium
- Product NameOmeprazole sodium
- CAS95510-70-6
- MFC17H20N3NaO3S
- MW369.41
- EINECS623-285-9
- MOL File95510-70-6.mol
Chemical Properties
| Melting point | >165°C (dec.) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Freely soluble in water and in ethanol (96 per cent), soluble in propylene glycol, very slightly soluble in methylene chloride. |
| form | Solid |
| color | White to Off-White |
| Stability | Hygroscopic |
| InChI | InChI=1S/C17H19N3O3S.Na.H/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17;;/h5-8H,9H2,1-4H3,(H,19,20);; |
| InChIKey | PZAYRNAPBZQNAO-UHFFFAOYSA-N |
| SMILES | S(C1NC2C=CC(OC)=CC=2N=1)(=O)CC1N=CC(C)=C(OC)C=1C.[NaH] |
| CAS DataBase Reference | 95510-70-6(CAS DataBase Reference) |