Benzyl 3-oxopiperazine-1-carboxylate
- Product NameBenzyl 3-oxopiperazine-1-carboxylate
- CAS78818-15-2
- MFC12H14N2O3
- MW234.25
- EINECS
- MOL File78818-15-2.mol
Chemical Properties
| Melting point | 118-120°C |
| Boiling point | 459.8±45.0 °C(Predicted) |
| Density | 1.243±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 14.98±0.20(Predicted) |
| color | White to Orange to Green |
| InChI | 1S/C12H14N2O3/c15-11-8-14(7-6-13-11)12(16)17-9-10-4-2-1-3-5-10/h1-5H,6-9H2,(H,13,15) |
| InChIKey | BAHFPJFBMJTOPU-UHFFFAOYSA-N |
| SMILES | O=C1CN(CCN1)C(=O)OCc2ccccc2 |
| CAS DataBase Reference | 78818-15-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |