4,7-Dimethyl-1,10-phenanthroline
- Product Name4,7-Dimethyl-1,10-phenanthroline
- CAS3248-05-3
- MFC14H12N2
- MW208.26
- EINECS221-827-5
- MOL File3248-05-3.mol
Chemical Properties
| Melting point | 193-195 °C(lit.) |
| Boiling point | 338.63°C (rough estimate) |
| Density | 1.1202 (rough estimate) |
| refractive index | 1.6152 (estimate) |
| Flash point | 177.00°C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 6.01±0.10(Predicted) |
| form | powder to crystal |
| color | White to Gray to Brown |
| Water Solubility | Soluble in benzene and alcohol. Slightly soluble in water. |
| InChI | InChI=1S/C14H12N2/c1-9-5-7-15-13-11(9)3-4-12-10(2)6-8-16-14(12)13/h3-8H,1-2H3 |
| InChIKey | JIVLDFFWTQYGSR-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C3C=2N=CC=C3C)C(C)=CC=1 |
| CAS DataBase Reference | 3248-05-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,7-Dimethyl-1,10-phenanthroline(3248-05-3) |
| EPA Substance Registry System | 1,10-Phenanthroline, 4,7-dimethyl- (3248-05-3) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
