2,4,5-Trichloropyrimidine
- Product Name2,4,5-Trichloropyrimidine
- CAS5750-76-5
- MFC4HCl3N2
- MW183.42
- EINECS628-281-0
- MOL File5750-76-5.mol
Chemical Properties
| Boiling point | 84°C 1mm |
| Density | 1.6001 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | -4.26±0.29(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 4449 |
| InChI | InChI=1S/C4HCl3N2/c5-2-1-8-4(7)9-3(2)6/h1H |
| InChIKey | GIKMWFAAEIACRF-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Cl)C(Cl)=N1 |
| CAS DataBase Reference | 5750-76-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3267 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |