| Melting point |
135.0 to 139.0 °C |
| Boiling point |
105 °C(Press: 0.15 Torr) |
| Density |
1.180±0.06 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| pka |
11.97±0.20(Predicted) |
| color |
White to Almost white |
| InChI |
InChI=1S/C8H11NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h5-6H,1-4H2,(H,9,10,11) |
| InChIKey |
WLDMPODMCFGWAA-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2C(CCCC2)C(=O)N1 |
| CAS DataBase Reference |
1444-94-6(CAS DataBase Reference) |
| EPA Substance Registry System |
1H-Isoindole-1,3(2H)-dione, hexahydro- (1444-94-6) |
