1-(4-Propylphenyl)ethan-1-one
- Product Name1-(4-Propylphenyl)ethan-1-one
- CAS2932-65-2
- MFC11H14O
- MW162.23
- EINECS220-903-5
- MOL File2932-65-2.mol
Chemical Properties
| Boiling point | 123-125°C (15 mmHg) |
| Density | 0,98 g/cm3 |
| refractive index | 1.5225 |
| Flash point | 251-252°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Clear Colourless Liquid |
| color | Colorless to Orange to Green |
| Specific Gravity | 0.98 |
| BRN | 1858604 |
| InChI | InChI=1S/C11H14O/c1-3-4-10-5-7-11(8-6-10)9(2)12/h5-8H,3-4H2,1-2H3 |
| InChIKey | ZNBVIYMIVFKTIW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(CCC)C=C1)C |
| CAS DataBase Reference | 2932-65-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-N-Propylacetophenone(2932-65-2) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 23-26-36/37/39-24/25 |
| Hazard Note | Irritant |
| HS Code | 29143990 |
