6-Methoxyflavone
- Product Name6-Methoxyflavone
- CAS26964-24-9
- MFC16H12O3
- MW252.26
- EINECS248-144-5
- MOL File26964-24-9.mol
Chemical Properties
| Melting point | 163-165 °C(lit.) |
| Boiling point | 421.2±45.0 °C(Predicted) |
| Density | 1.240±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C16H12O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | XZQLSABETMKIGG-UHFFFAOYSA-N |
| SMILES | COc1ccc2OC(=CC(=O)c2c1)c3ccccc3 |
| LogP | 3.470 (est) |
| CAS DataBase Reference | 26964-24-9(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 2 |
| RTECS | DJ3100438 |
| HS Code | 2914.50.3000 |
| Storage Class | 11 - Combustible Solids |