TRANS-2-UNDECENAL
- Product NameTRANS-2-UNDECENAL
- CAS53448-07-0
- MFC11H20O
- MW168.28
- EINECS258-559-3
- MOL File53448-07-0.mol
Chemical Properties
| Melting point | 115° |
| Boiling point | 115 °C10 mm Hg(lit.) |
| Density | 0.849 g/mL at 25 °C(lit.) |
| FEMA | 3423 | 2-UNDECENAL |
| refractive index | n |
| Flash point | >230 °F |
| form | clear liquid |
| color | Colorless to Light yellow |
| Odor | at 1.00 % in dipropylene glycol. fresh fruity citrus orange peel |
| Odor Type | fruity |
| biological source | synthetic |
| BRN | 1762239 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C11H20O/c1-2-3-4-5-6-7-8-9-10-11-12/h9-11H,2-8H2,1H3/b10-9+ |
| InChIKey | PANBRUWVURLWGY-MDZDMXLPSA-N |
| SMILES | [H]C(=O)\C([H])=C(/[H])CCCCCCCC |
| LogP | 4.23 |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2912.19.5000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 |
