| Melting point |
336-342°C |
| Boiling point |
590.9±39.0 °C(Predicted) |
| Density |
1.242±0.06 g/cm3(Predicted) |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
almost transparency in hot DMF |
| form |
powder to crystal |
| pka |
2.95±0.10(Predicted) |
| color |
Light yellow to Amber to Dark green |
| Water Solubility |
2.236ng/L at 25℃ |
| InChI |
InChI=1S/C30H22N2O2/c1-19-3-15-27-25(17-19)31-29(33-27)23-11-7-21(8-12-23)5-6-22-9-13-24(14-10-22)30-32-26-18-20(2)4-16-28(26)34-30/h3-18H,1-2H3 |
| InChIKey |
OKEZAUMKBWTTCR-UHFFFAOYSA-N |
| SMILES |
C(C1=CC=C(C2=NC3=CC(C)=CC=C3O2)C=C1)=CC1=CC=C(C2=NC3=CC(C)=CC=C3O2)C=C1 |
| LogP |
8.6 |
| CAS DataBase Reference |
2397-00-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzoxazole, 2,2'-(1,2-ethenediyldi-4,1-phenylene)bis[5-methyl- (2397-00-4) |