| Melting point |
117.0 to 121.0 °C |
| Boiling point |
475.3±40.0 °C(Predicted) |
| Density |
1.5311 (rough estimate) |
| refractive index |
1.6500 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| pka |
3.83±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
-13.9 ° (C=0.011374 g/ml, MEOH) |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C14H18BrNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m1/s1 |
| InChIKey |
ULNOXUAEIPUJMK-LLVKDONJSA-N |
| SMILES |
C(O)(=O)[C@@H](CC1=CC=C(Br)C=C1)NC(OC(C)(C)C)=O |
| CAS DataBase Reference |
79561-82-3(CAS DataBase Reference) |