5-Chloro-2-nitroaniline
- Product Name5-Chloro-2-nitroaniline
- CAS1635-61-6
- MFC6H5ClN2O2
- MW172.57
- EINECS216-661-5
- MOL File1635-61-6.mol
Chemical Properties
| Melting point | 125-129 °C (dec.)(lit.) |
| Boiling point | 200°C (rough estimate) |
| Density | 1.5610 (rough estimate) |
| refractive index | 1.5870 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Chloroform, Methanol |
| pka | -1.46±0.25(Predicted) |
| form | Liquid |
| color | Clear colorless to light yellow |
| BRN | 2210201 |
| InChI | InChI=1S/C6H5ClN2O2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H,8H2 |
| InChIKey | ZCWXYZBQDNFULS-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Cl)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 1635-61-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T+,N,T |
| Risk Statements | 26/27/28-33-51/53 |
| Safety Statements | 28-36/37-45-61-28A |
| RIDADR | UN 2237 6.1/PG 3 |
| WGK Germany | 3 |
| F | 9-23 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214210 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 STOT RE 2 |