| Melting point |
>350 °C (lit.) |
| Density |
1.30 g/cm3 |
| refractive index |
1.61 |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
powder to crystal |
| color |
White to Almost white |
| Specific Gravity |
1.35 |
| Hydrolytic Sensitivity |
1: no significant reaction with aqueous systems |
| InChIKey |
KBXJHRABGYYAFC-UHFFFAOYSA-N |
| SMILES |
O1[Si]2(O[Si]3(O[Si]4(O[Si]1(O[Si]5(O[Si](O2)(O[Si](O3)(O[Si](O4)(O5)c6ccccc6)c7ccccc7)c8ccccc8)c9ccccc9)c%10ccccc%10)c%11ccccc%11)c%12ccccc%12)c%13ccccc%13 |
| CAS DataBase Reference |
5256-79-1 |
| NIST Chemistry Reference |
Silsesquioxane, phenyl-, cubical octamer(5256-79-1) |
| EPA Substance Registry System |
Pentacyclo[9.5.1.13,9.15,15.17,13]octasiloxane, 1,3,5,7,9,11,13,15-octaphenyl- (5256-79-1) |
