| Melting point |
260-265 °C (dec.) |
| alpha |
D27 -5° (c = 0.25) |
| Boiling point |
410.43°C (rough estimate) |
| Density |
1.3382 (rough estimate) |
| refractive index |
1.7610 (estimate) |
| storage temp. |
-20°C |
| solubility |
DMSO (Slightly, Heated) |
| form |
Powder |
| pka |
pKa 3.55(H2O
t=20
I=0.1 (KCl)) (Uncertain);11.4 (Uncertain) |
| color |
White to Off-white |
| Water Solubility |
Soluble in DMF (10 mg/ml), 0.5 M HCl (50 mg/ml), DMSO (53 mg/ml at 25°C), ethanol (<1 mg/ml at 25°C), and water (3 mg/ml at 25°C). |
| Merck |
13,10039 |
| BRN |
624881 |
| InChI |
1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7+,10-/m1/s1 |
| InChIKey |
OIRDTQYFTABQOQ-UHTZMRCNSA-N |
| SMILES |
Nc1ncnc2n(cnc12)[C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3O |
| LogP |
-0.755 (est) |
| CAS DataBase Reference |
5536-17-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Vidarabine (5536-17-4) |