| Melting point |
234-236 °C (lit.) |
| Boiling point |
410.43°C (rough estimate) |
| alpha |
D11 -61.7° (c = 0.706 in water); 9D -58.2° (c = 0.658 in water) |
| Density |
1.3382 (rough estimate) |
| refractive index |
1.7610 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Slightly soluble in water, soluble in hot water, practically insoluble in ethanol (96 per cent) and in methylene chloride. It dissolves in dilute mineral acids. |
| form |
Crystalline Powder |
| pka |
3.6, 12.4(at 25℃) |
| color |
White |
| PH |
3.59;12.5 |
| biological source |
synthetic (organic) |
| optical activity |
[α]20/D 70±3°, c = 2% in 5% NaOH |
| Water Solubility |
Soluble in water, ammonium hydroxide and dimethyl sulfoxide. Insoluble in ethanol. |
| λmax |
257 (pH 1);260 (pH 6) |
| Merck |
14,153 |
| BRN |
93029 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING |
| Cosmetic Ingredient Review (CIR) |
Adenosine (58-61-7) |
| InChI |
1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 |
| InChIKey |
OIRDTQYFTABQOQ-KQYNXXCUSA-N |
| SMILES |
Nc1ncnc2n(cnc12)[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O |
| LogP |
-0.755 (est) |
| CAS DataBase Reference |
58-61-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
adenosine(58-61-7) |
| EPA Substance Registry System |
Adenosine (58-61-7) |