| Melting point |
374-392 °C |
| Density |
1.58 g/cm3 |
| storage temp. |
2-8°C |
| solubility |
Sparingly soluble in water, freely soluble in boiling water, slightly soluble in alcohol and in methanol. |
| form |
solid |
| pka |
4.8(at 25℃) |
| color |
White to Off-White |
| Odor |
wh. cryst. or cryst. powd., sl. char. odor |
| biological source |
synthetic |
| Merck |
14,9295 |
| BRN |
3857790 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING |
| InChI |
InChI=1S/C12H17N4OS.NO3/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;2-1(3)4/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);/q+1;-1 |
| InChIKey |
UIERGBJEBXXIGO-UHFFFAOYSA-N |
| SMILES |
[N+]1(CC2=CN=C(C)N=C2N)C(C)=C(SC=1)CCO.[N+]([O-])([O-])=O |
| CAS DataBase Reference |
532-43-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Thiamine nitrate (532-43-4) |