| Melting point |
141-143℃ (ethanol ) |
| Boiling point |
424.99°C (rough estimate) |
| Density |
1.0741 (rough estimate) |
| refractive index |
1.5700 (estimate) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
ethanol: 20 mg/mL |
| form |
solid |
| pka |
7.55±0.40(Predicted) |
| color |
yellow |
| biological source |
synthetic (organic) |
| Stability |
Stable for 2 years from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 3 months. |
| InChI |
1S/C18H22N2O/c1-17(2,3)14-8-12(7-13(10-19)11-20)9-15(16(14)21)18(4,5)6/h7-9,21H,1-6H3 |
| InChIKey |
MZOPWQKISXCCTP-UHFFFAOYSA-N |
| SMILES |
CC(C)(C)c1cc(\C=C(\C#N)C#N)cc(c1O)C(C)(C)C |
| CAS DataBase Reference |
10537-47-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Malonoben (10537-47-0) |
