| Melting point |
236 °C |
| Boiling point |
228 °C |
| Density |
1.078 |
| Flash point |
193°C |
| storage temp. |
Store at room temperature |
| form |
solid |
| Specific Gravity |
1.078 |
| color |
White to Almost white |
| Water Solubility |
Insoluble in water. |
| Hydrolytic Sensitivity |
1: no significant reaction with aqueous systems |
| BRN |
1885911 |
| InChI |
InChI=1S/C24H20Si/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey |
JLAVCPKULITDHO-UHFFFAOYSA-N |
| SMILES |
[Si](C1=CC=CC=C1)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference |
1048-08-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Silane, tetraphenyl- (1048-08-4) |
