| Melting point |
120-124 °C(lit.) |
| Boiling point |
552.68°C (rough estimate) |
| Density |
1.4899 (rough estimate) |
| refractive index |
1.4570 (estimate) |
| storage temp. |
Store at RT. |
| solubility |
Insoluble in water; soluble in ethanol, acetone, benzene, toluene, xylene, ethylene glycol |
| form |
Powder/Solid |
| Colour Index |
26150 |
| pka |
2.94±0.40(Predicted) |
| color |
Very dark brown to black |
| Water Solubility |
Soluble in oils, fats, warm petrolatum, paraffin, phenol, ethanol, acetone, benzene, toluene and hydrocarbon. Insoluble in water. |
| λmax |
598 nm, 415 nm |
| ε(extinction coefficient) |
≥20000 at 596-603nm in ethanol |
| Merck |
13,8970 |
| BRN |
723248 |
| Stability |
Light Sensitive |
| Biological Applications |
Diagnosis of acute myeloid leukemia (AML); detecting neuron-specific nuclear protein NeuN; drug screening |
| Major Application |
diagnostic assay manufacturing
hematology
histology |
| Cosmetics Ingredients Functions |
HAIR DYEING |
| InChI |
1S/C29H24N6/c1-29(2)30-26-14-8-13-22-25(17-18-27(31-29)28(22)26)35-34-24-16-15-23(20-11-6-7-12-21(20)24)33-32-19-9-4-3-5-10-19/h3-18,30-31H,1-2H3/b33-32+,35-34+ |
| InChIKey |
YCUVUDODLRLVIC-VPHDGDOJSA-N |
| SMILES |
CC1(C)Nc2cccc3c(ccc(N1)c23)\N=N\c4ccc(\N=N\c5ccccc5)c6ccccc46 |
| CAS DataBase Reference |
4197-25-5(CAS DataBase Reference) |
| EPA Substance Registry System |
C.I. Solvent Black 3 (4197-25-5) |
