Melting point |
114-116 °C(lit.) |
Boiling point |
227℃ |
Density |
1.153 |
Flash point |
91.1℃ |
refractive index |
1.5000 |
storage temp. |
Sealed in dry,Store in freezer, under -20°C |
solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
pka |
2.37±0.20(Predicted) |
form |
Powder |
color |
White to off-white |
Water Solubility |
Soluble in water and methanol(both 50 mg/ml-clear-colorless solution) |
InChI |
InChI=1S/C6H11NO2/c1-7-4-2-3-5(7)6(8)9/h5H,2-4H2,1H3,(H,8,9)/t5-/m0/s1 |
InChIKey |
CWLQUGTUXBXTLF-YFKPBYRVSA-N |
SMILES |
C(O)(=O)[C@@H]1CCCN1C |
CAS DataBase Reference |
475-11-6 |