| Melting point |
88-90 |
| Boiling point |
63.6°C (rough estimate) |
| Density |
1.3840 (rough estimate) |
| refractive index |
1.5790 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Practically insoluble in water, freely soluble in acetone and in methylene chloride, soluble in ethanol (96 per cent). |
| form |
Solid |
| pka |
10.88±0.20(Predicted) |
| color |
Light orange to Yellow to Green |
| Merck |
14,5564 |
| Henry's Law Constant |
5.5×104 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI |
InChI=1S/C9H16ClN3O2/c10-6-7-13(12-15)9(14)11-8-4-2-1-3-5-8/h8H,1-7H2,(H,11,14) |
| InChIKey |
GQYIWUVLTXOXAJ-UHFFFAOYSA-N |
| SMILES |
N(CCCl)(N=O)C(NC1CCCCC1)=O |
| CAS DataBase Reference |
13010-47-4(CAS DataBase Reference) |
| IARC |
2A (Vol. 26, Sup 7) 1987 |
| EPA Substance Registry System |
1-(2-Chloroethyl)-3-cyclohexyl-1-nitrosourea (13010-47-4) |
