| Melting point |
170-172 °C(lit.) |
| alpha |
12 º (c=20, H2O) |
| Boiling point |
191.59°C (rough estimate) |
| Density |
1.76 |
| bulk density |
1000kg/m3 |
| vapor density |
5.18 (vs air) |
| vapor pressure |
<5 Pa (20 °C) |
| FEMA |
3044 | TARTARIC ACID (D-, L-, DL-, MESO-) |
| refractive index |
12.5 ° (C=5, H2O) |
| Flash point |
210 °C |
| storage temp. |
Store at +5°C to +30°C. |
| solubility |
H2O: soluble1M at 20°C, clear, colorless |
| form |
Solid |
| pka |
2.98, 4.34(at 25℃) |
| color |
White or colorless |
| PH |
3.18(1 mM solution);2.55(10 mM solution);2.01(100 mM solution); |
| Odor |
at 100.00 %. odorless |
| Odor Type |
odorless |
| biological source |
Vitis vinifera |
| optical activity |
[α]20/D +13.5±0.5°, c = 10% in H2O |
| Water Solubility |
1390 g/L (20 ºC) |
| Merck |
14,9070 |
| JECFA Number |
621 |
| BRN |
1725147 |
| Dielectric constant |
35.9(-10℃) |
| Stability |
Stable. Incompatible with oxidizing agents, bases, reducing agents. Combustible. |
| Cosmetics Ingredients Functions |
FRAGRANCE BUFFERING |
| InChI |
1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
| InChIKey |
FEWJPZIEWOKRBE-JCYAYHJZSA-N |
| SMILES |
O[C@H]([C@@H](O)C(O)=O)C(O)=O |
| LogP |
-1.43 |
| CAS DataBase Reference |
87-69-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
Butanedioic acid, 2,3-dihydroxy- [r-(r*,r*)]-(87-69-4) |
| EPA Substance Registry System |
Tartaric acid (87-69-4) |