| Melting point |
210-212 °C(lit.) |
| Boiling point |
191.59°C (rough estimate) |
| alpha |
[α]D20 -0.2~+0.2° (c=20, H2O) |
| Density |
1.788 |
| vapor pressure |
<0.1 hPa (20 °C) |
| refractive index |
1.5860 (estimate) |
| FEMA |
3044 | TARTARIC ACID (D-, L-, DL-, MESO-) |
| Flash point |
210 °C |
| storage temp. |
Store below +30°C. |
| solubility |
H2O: 0.1 g/mL, clear |
| form |
Liquid |
| pka |
3.03, 4.37(at 25℃) |
| color |
White |
| PH |
3.19(1 mM solution);2.58(10 mM solution);2.03(100 mM solution); |
| Odor |
at 100.00 %. very mild caramellic |
| Odor Type |
odorless |
| biological source |
synthetic |
| Water Solubility |
soluble |
| Merck |
14,9069 |
| JECFA Number |
621 |
| BRN |
1725148 |
| Dielectric constant |
35.9(-10℃) |
| Stability |
Stable. Incompatible with bases, oxidizing agents, reducing agents, silver. |
| Major Application |
flavors and fragrances |
| Cosmetics Ingredients Functions |
BUFFERING FRAGRANCE |
| InChI |
1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m0/s1 |
| InChIKey |
FEWJPZIEWOKRBE-UHFFFAOYSA-N |
| SMILES |
O[C@@H]([C@H](O)C(O)=O)C(O)=O |
| LogP |
-1.43 |
| CAS DataBase Reference |
133-37-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
Tartaric acid(133-37-9) |
| EPA Substance Registry System |
Butanedioic acid, 2,3-dihydroxy-, (2R,3R)-rel- (133-37-9) |