| Melting point |
172-175 °C (lit.) |
| Boiling point |
381.66°C (rough estimate) |
| Density |
1.0597 (rough estimate) |
| refractive index |
1.4800 (estimate) |
| storage temp. |
-20°C |
| solubility |
Practically insoluble in water, soluble in methylene chloride, slightly soluble in ethanol (96 per cent). It is sensitive to air, heat and light, especially in solution. Carry out all operations as rapidly as possible and avoid exposure to actinic light; use freshly prepared solutions. |
| form |
Fine Crystalline Powder |
| pka |
4.76±0.33(Predicted) |
| color |
Yellow-orange to orange |
| biological source |
synthetic |
| Water Solubility |
insoluble |
| λmax |
354nm(EtOH)(lit.) |
| Merck |
14,5228 |
| Stability |
Stable, but probably air and light sensitive. Combustible. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
ANTI-SEBUM |
| InChI |
1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/b9-6+,12-11+,15-8+,16-14- |
| InChIKey |
SHGAZHPCJJPHSC-YCNIQYBTSA-N |
| SMILES |
[H]\C(C(O)=O)=C(C)\C=C\C=C(C)\C=C\C1=C(C)CCCC1(C)C |
| CAS DataBase Reference |
4759-48-2(CAS DataBase Reference) |
| EPA Substance Registry System |
Isotretinoin (4759-48-2) |