| Melting point |
169-172 °C (dec.) (lit.) |
| alpha |
-17.25 º (c=10, H2O 25 ºC) |
| Boiling point |
227.71°C (rough estimate) |
| Density |
1.3744 (rough estimate) |
| vapor pressure |
0Pa at 25℃ |
| FEMA |
2410 | ERYTHROBIC ACID |
| refractive index |
-17.5 ° (C=10, H2O) |
| storage temp. |
2-8°C |
| solubility |
H2O: 0.1 g/mL, clear, colorless to very faintly yellow |
| pka |
4.09±0.10(Predicted) |
| form |
Crystals or Crystalline Powder |
| color |
White to slightly yellow |
| Odor |
odorless |
| biological source |
(Starch) |
| optical activity |
[α]25/D 16.8°, c = 2 in H2O |
| Water Solubility |
1g/10mL |
| Merck |
14,5126 |
| BRN |
84271 |
| Henry's Law Constant |
2.4×102 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable. Combustible. Incompatible with chemically active metals, aluminium, zinc, copper, magnesium, strong bases, strong oxidizing agents. |
| Cosmetics Ingredients Functions |
ANTIOXIDANT |
| Cosmetic Ingredient Review (CIR) |
Erythorbic Acid (89-65-6) |
| InChI |
1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5-/m1/s1 |
| InChIKey |
CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
| SMILES |
[H][C@@]1(OC(=O)C(O)=C1O)[C@H](O)CO |
| LogP |
-1.69 at 25℃ |
| CAS DataBase Reference |
89-65-6(CAS DataBase Reference) |
| EPA Substance Registry System |
Isoascorbic acid (89-65-6) |