| Melting point |
160-162 °C (lit.) |
| Boiling point |
454.02°C (rough estimate) |
| Density |
1.1523 (rough estimate) |
| refractive index |
1.6000 (estimate) |
| storage temp. |
Refrigerator |
| solubility |
DMSO (Slightly, Sonicated), Methanol (Slightly, Sonicated) |
| Colour Index |
11110 |
| form |
Solid |
| pka |
14.55±0.10(Predicted) |
| color |
Dark Red to Very Dark Red |
| Water Solubility |
169.7ug/L(25 ºC) |
| λmax |
502 nm |
| BRN |
5353614 |
| Major Application |
cleaning products
cosmetics
environmental
food and beverages
personal care |
| InChI |
1S/C16H18N4O3/c1-2-19(11-12-21)15-7-3-13(4-8-15)17-18-14-5-9-16(10-6-14)20(22)23/h3-10,21H,2,11-12H2,1H3/b18-17+ |
| InChIKey |
FOQABOMYTOFLPZ-ISLYRVAYSA-N |
| SMILES |
CCN(CCO)c1ccc(cc1)\N=N\c2ccc(cc2)[N+]([O-])=O |
| CAS DataBase Reference |
2872-52-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
Ethanol, 2-[ethyl[4-[(4-nitrophenyl)azo]phenyl]amino]-(2872-52-8) |
| EPA Substance Registry System |
C.I. Disperse Red 1 (2872-52-8) |
