Disperse Red 1
- Product NameDisperse Red 1
- CAS2872-52-8
- CBNumberCB8135175
- MFC16H18N4O3
- MW314.34
- EINECS220-704-3
- MDL NumberMFCD00007312
- MOL File2872-52-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 160-162 °C (lit.) |
| Boiling point | 454.02°C (rough estimate) |
| Density | 1.1523 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Sonicated) |
| Colour Index | 11110 |
| form | Solid |
| pka | 14.55±0.10(Predicted) |
| color | Dark Red to Very Dark Red |
| Water Solubility | 169.7ug/L(25 ºC) |
| λmax | 502 nm |
| BRN | 5353614 |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C16H18N4O3/c1-2-19(11-12-21)15-7-3-13(4-8-15)17-18-14-5-9-16(10-6-14)20(22)23/h3-10,21H,2,11-12H2,1H3/b18-17+ |
| InChIKey | FOQABOMYTOFLPZ-ISLYRVAYSA-N |
| SMILES | CCN(CCO)c1ccc(cc1)\N=N\c2ccc(cc2)[N+]([O-])=O |
| CAS DataBase Reference | 2872-52-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| RTECS | KL0320000 |
| TSCA | TSCA listed |
| HS Code | 32041100 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |